EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N3O3 |
| Net Charge | 0 |
| Average Mass | 367.449 |
| Monoisotopic Mass | 367.18959 |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CN(C)C)c1ccccc1CC2 |
| InChI | InChI=1S/C21H25N3O3/c1-4-27-21(26)22-17-12-11-16-10-9-15-7-5-6-8-18(15)24(19(16)13-17)20(25)14-23(2)3/h5-8,11-13H,4,9-10,14H2,1-3H3,(H,22,26) |
| InChIKey | KJAMZCVTJDTESW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tiracizine (CHEBI:135549) has role cardiovascular drug (CHEBI:35554) |
| tiracizine (CHEBI:135549) is a dibenzooxazepine (CHEBI:53802) |
| INN | Source |
|---|---|
| tiracizina | WHO MedNet |
| Synonym | Source |
|---|---|
| Tiracizine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2679 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:83275-56-3 | DrugCentral |
| Citations |
|---|