EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O2S |
| Net Charge | 0 |
| Average Mass | 366.446 |
| Monoisotopic Mass | 366.11505 |
| SMILES | COc1ccnc(CS(=O)c2nc3ccc(-n4cccc4)cc3n2)c1C |
| InChI | InChI=1S/C19H18N4O2S/c1-13-17(20-8-7-18(13)25-2)12-26(24)19-21-15-6-5-14(11-16(15)22-19)23-9-3-4-10-23/h3-11H,12H2,1-2H3,(H,21,22) |
| InChIKey | HRRXCXABAPSOCP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilaprazole (CHEBI:135544) has role anti-ulcer drug (CHEBI:49201) |
| ilaprazole (CHEBI:135544) is a benzimidazoles (CHEBI:22715) |
| ilaprazole (CHEBI:135544) is a sulfoxide (CHEBI:22063) |
| INN | Source |
|---|---|
| ilaprazol | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ilaprazole | ChEMBL |
| IY 81149 | DrugCentral |
| IY-81149 | DrugCentral |
| IY81149 | DrugCentral |
| noltec | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3961 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:172152-36-2 | DrugCentral |