EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O5 |
| Net Charge | 0 |
| Average Mass | 366.413 |
| Monoisotopic Mass | 366.14672 |
| SMILES | COc1cc(C=C2CCCC(=Cc3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C22H22O5/c1-26-20-12-14(6-8-18(20)23)10-16-4-3-5-17(22(16)25)11-15-7-9-19(24)21(13-15)27-2/h6-13,23-24H,3-5H2,1-2H3 |
| InChIKey | DHKKONBXGAAFTB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclovalone (CHEBI:135543) is a diarylheptanoid (CHEBI:78802) |
| Synonyms | Source |
|---|---|
| curcumoid | DrugCentral |
| cyclovalon | DrugCentral |
| cycvalon | DrugCentral |
| cyqualon | DrugCentral |
| vanilone | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 762 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:579-23-7 | DrugCentral |