EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClNO5 |
| Net Charge | 0 |
| Average Mass | 363.797 |
| Monoisotopic Mass | 363.08735 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C18H18ClNO5/c1-18(2,25-15-7-5-14(19)6-8-15)17(22)24-11-10-23-16(21)13-4-3-9-20-12-13/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | XXRVYAFBUDSLJX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etofibrate (CHEBI:135535) has role cardiovascular drug (CHEBI:35554) |
| etofibrate (CHEBI:135535) is a monocarboxylic acid (CHEBI:25384) |
| etofibrate (CHEBI:135535) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| etofibrato | WHO MedNet |
| Synonyms | Source |
|---|---|
| ethofibrate | DrugCentral |
| Etofibrate | ChEMBL |
| etofibrate HCl | DrugCentral |
| etofibrate hydrochloride | DrugCentral |
| tricerol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1106 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:31637-97-5 | DrugCentral |
| Citations |
|---|