EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33N3O3 |
| Net Charge | 0 |
| Average Mass | 363.502 |
| Monoisotopic Mass | 363.25219 |
| SMILES | CC(C)(C)NCC(O)COc1ccc(NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H33N3O3/c1-20(2,3)21-13-17(24)14-26-18-11-9-16(10-12-18)23-19(25)22-15-7-5-4-6-8-15/h9-12,15,17,21,24H,4-8,13-14H2,1-3H3,(H2,22,23,25) |
| InChIKey | MXFWWQICDIZSOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talinolol (CHEBI:135533) has role anti-obesity agent (CHEBI:74518) |
| talinolol (CHEBI:135533) has role cardiovascular drug (CHEBI:35554) |
| talinolol (CHEBI:135533) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| cordanum | DrugCentral |
| racemic talinolol | DrugCentral |
| (+/-)-Talinolol | DrugCentral |
| Talinolol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2557 | DrugCentral |
| HMDB0042020 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:57460-41-0 | DrugCentral |
| Citations |
|---|