EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO2 |
| Net Charge | 0 |
| Average Mass | 361.485 |
| Monoisotopic Mass | 361.20418 |
| SMILES | CCCCC(CC)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c1-3-5-12-19(4-2)18-27-24(26)22(17-25)23(20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16,19H,3-5,12,18H2,1-2H3 |
| InChIKey | FMJSMJQBSVNSBF-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octocrylene (CHEBI:135526) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| octocrileno | WHO MedNet |
| Synonyms | Source |
|---|---|
| NSC-760433 | ChEMBL |
| octocrilene | DrugCentral |
| Octocrylene | ChEMBL |
| Brand Names | Source |
|---|---|
| Octocrylene component of anthelios sx | ChEMBL |
| Octocrylene component of capital soleil | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3395 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:6197-30-4 | DrugCentral |