EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29NS2 |
| Net Charge | 0 |
| Average Mass | 359.604 |
| Monoisotopic Mass | 359.17414 |
| SMILES | CCCCSc1ccc(C(SCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H29NS2/c1-4-5-16-23-20-13-11-19(12-14-20)21(24-17-15-22(2)3)18-9-7-6-8-10-18/h6-14,21H,4-5,15-17H2,1-3H3 |
| InChIKey | IZLPZXSZLLELBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| captodiame (CHEBI:135521) has role anxiolytic drug (CHEBI:35474) |
| captodiame (CHEBI:135521) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| captodiamo | WHO MedNet |
| Synonyms | Source |
|---|---|
| captodiam | DrugCentral |
| Captodiame | ChEMBL |
| captodiamin | DrugCentral |
| captodiamine | DrugCentral |
| captodiamine HCl | DrugCentral |
| captodiamine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 483 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:486-17-9 | DrugCentral |