EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28NO4 |
| Net Charge | +1 |
| Average Mass | 358.458 |
| Monoisotopic Mass | 358.20128 |
| SMILES | C[N+]1(CC2CC2)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C21H28NO4/c1-22(11-13-7-8-13)17-9-15(10-18(22)20-19(17)26-20)25-21(24)16(12-23)14-5-3-2-4-6-14/h2-6,13,15-20,23H,7-12H2,1H3/q+1/t15-,16-,17-,18+,19-,20+,22?/m1/s1 |
| InChIKey | QVVOZYKELHAIPX-WVHCHWADSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cimetropium (CHEBI:135516) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| cimetropium bromide | DrugCentral |
| cyclopropylmethylscopolamine bromide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 646 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:51598-60-8 | DrugCentral |