EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 358.269 |
| Monoisotopic Mass | 357.10108 |
| SMILES | Cn1c(CCCC(=O)O)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-20-14-6-5-12(21(9-7-17)10-8-18)11-13(14)19-15(20)3-2-4-16(22)23/h5-6,11H,2-4,7-10H2,1H3,(H,22,23) |
| InChIKey | YTKUWDBFDASYHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bendamustine (CHEBI:135515) has role anti-anaemic agent (CHEBI:75835) |
| bendamustine (CHEBI:135515) has role antineoplastic agent (CHEBI:35610) |
| bendamustine (CHEBI:135515) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| bendamustina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bendamustine | ChEMBL |
| bendamustine HCl | DrugCentral |
| bendamustine hydrochloride | DrugCentral |
| treanda | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 302 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:16506-27-7 | DrugCentral |
| Citations |
|---|