EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N2O2 |
| Net Charge | 0 |
| Average Mass | 356.510 |
| Monoisotopic Mass | 356.24638 |
| SMILES | Oc1ccc(CCNCCCCCCNCCc2ccccc2)cc1O |
| InChI | InChI=1S/C22H32N2O2/c25-21-11-10-20(18-22(21)26)13-17-24-15-7-2-1-6-14-23-16-12-19-8-4-3-5-9-19/h3-5,8-11,18,23-26H,1-2,6-7,12-17H2 |
| InChIKey | RYBJORHCUPVNMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dopexamine (CHEBI:135507) is a catecholamine (CHEBI:33567) |
| Manual Xrefs | Databases |
|---|---|
| 948 | DrugCentral |
| HMDB0041882 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:86197-47-9 | DrugCentral |