EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FNO2 |
| Net Charge | 0 |
| Average Mass | 355.453 |
| Monoisotopic Mass | 355.19476 |
| SMILES | Cc1ccc(C2(O)CCN(CCCC(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26FNO2/c1-17-4-8-19(9-5-17)22(26)12-15-24(16-13-22)14-2-3-21(25)18-6-10-20(23)11-7-18/h4-11,26H,2-3,12-16H2,1H3 |
| InChIKey | AGAHNABIDCTLHW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moperone (CHEBI:135500) has role antipsychotic agent (CHEBI:35476) |
| moperone (CHEBI:135500) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| moperona | WHO MedNet |
| Synonyms | Source |
|---|---|
| luvatren | DrugCentral |
| luvatrena | DrugCentral |
| meperon | DrugCentral |
| methylperidol | DrugCentral |
| Moperone | ChEMBL |
| moperone HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1837 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1050-79-9 | DrugCentral |
| Citations |
|---|