EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15ClN2O4S |
| Net Charge | 0 |
| Average Mass | 354.815 |
| Monoisotopic Mass | 354.04411 |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1O |
| InChI | InChI=1S/C15H15ClN2O4S/c1-8-4-3-5-9(2)14(8)18-15(20)10-6-13(23(17,21)22)11(16)7-12(10)19/h3-7,19H,1-2H3,(H,18,20)(H2,17,21,22) |
| InChIKey | MTZBBNMLMNBNJL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xipamide (CHEBI:135499) has role cardiovascular drug (CHEBI:35554) |
| xipamide (CHEBI:135499) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| xipamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| BE-1293 | ChEMBL |
| chronexan | DrugCentral |
| diurex | DrugCentral |
| diurexan | DrugCentral |
| MJF 10,938 | ChEMBL |
| MJF-10938 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2853 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:14293-44-8 | DrugCentral |
| Citations |
|---|