EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O2 |
| Net Charge | 0 |
| Average Mass | 352.518 |
| Monoisotopic Mass | 352.24023 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OC3=CCCC3)CC[C@@]21[H] |
| InChI | InChI=1S/C24H32O2/c1-23-13-11-17(25)15-16(23)7-8-19-20-9-10-22(26-18-5-3-4-6-18)24(20,2)14-12-21(19)23/h5,11,13,15,19-22H,3-4,6-10,12,14H2,1-2H3/t19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | IUVKMZGDUIUOCP-BTNSXGMBSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinbolone (CHEBI:135488) has role androgen (CHEBI:50113) |
| quinbolone (CHEBI:135488) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| anabolvis | DrugCentral |
| quindenione | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3823 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2487-63-0 | DrugCentral |