EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9Cl2F3N2O |
| Net Charge | 0 |
| Average Mass | 349.139 |
| Monoisotopic Mass | 348.00440 |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9Cl2F3N2O/c15-8-1-3-9(4-2-8)20-13(22)21-10-5-6-12(16)11(7-10)14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | ZFSXZJXLKAJIGS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| halocarban (CHEBI:135477) has part trifluoromethyl group (CHEBI:50127) |
| halocarban (CHEBI:135477) has role antibacterial agent (CHEBI:33282) |
| halocarban (CHEBI:135477) is a monochlorobenzenes (CHEBI:83403) |
| halocarban (CHEBI:135477) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| N-(4-chlorophenyl)-N'-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| INNs | Source |
|---|---|
| halocarban | WHO MedNet |
| halocarban | WHO MedNet |
| halocarbano | WHO MedNet |
| halocarbanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4,4'-Dichloro-3-(trifluoromethyl)carbanilide | ChemIDplus |
| cloflucarban | DrugCentral |
| N-(4-Chlorophenyl)-N'-(4-chloro-3-(trifluoromethyl)phenyl)urea | ChemIDplus |
| trifluoromethyldichlorocarbanilide | DrugCentral |
| Citations |
|---|