EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N4O |
| Net Charge | 0 |
| Average Mass | 348.450 |
| Monoisotopic Mass | 348.19501 |
| SMILES | Cc1cnc(NCCCN(C)C)c2c1nc1ccc3cc(O)ccc3c12 |
| InChI | InChI=1S/C21H24N4O/c1-13-12-23-21(22-9-4-10-25(2)3)19-18-16-7-6-15(26)11-14(16)5-8-17(18)24-20(13)19/h5-8,11-12,24,26H,4,9-10H2,1-3H3,(H,22,23) |
| InChIKey | QROONAIPJKQFMC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| intoplicine (CHEBI:135474) has role antineoplastic agent (CHEBI:35610) |
| intoplicine (CHEBI:135474) is a pyridoindole (CHEBI:48888) |
| INNs | Source |
|---|---|
| intoplicina | WHO MedNet |
| intoplicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| RP 60475 | ChEMBL |
| RP-60475 | DrugCentral |
| RP-60475 FREE BASE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1446 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:125974-72-3 | DrugCentral |
| Citations |
|---|