EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21NO7S |
| Net Charge | 0 |
| Average Mass | 347.389 |
| Monoisotopic Mass | 347.10387 |
| SMILES | [H][C@@]12CC(=O)N1[C@@H](C(=O)OCOC(=O)C(C)(C)C)C(C)(C)S2(=O)=O |
| InChI | InChI=1S/C14H21NO7S/c1-13(2,3)12(18)22-7-21-11(17)10-14(4,5)23(19,20)9-6-8(16)15(9)10/h9-10H,6-7H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | OHPVYKXTRACOSQ-ZJUUUORDSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulbactam pivoxil (CHEBI:135467) has role prodrug (CHEBI:50266) |
| sulbactam pivoxil (CHEBI:135467) is a penicillanic acid ester (CHEBI:51212) |
| sulbactam pivoxil (CHEBI:135467) is a pivaloyloxymethyl ester (CHEBI:136685) |
| IUPAC Name |
|---|
| [(2,2-dimethylpropanoyl)oxy]methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide |
| Synonyms | Source |
|---|---|
| CP 47904 | DrugBank |
| CP-47904 | DrugBank |
| CP-47,904 | DrugBank |
| sulbactam pivoxyl | ChEBI |
| (pivaloyloxy)methyl penicillanate S,S-dioxide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2493 | DrugCentral |
| DB15761 | DrugBank |
| CN101317843 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8173402 | Reaxys |
| CAS:69388-79-0 | DrugBank |
| Citations |
|---|