EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N5O2 |
| Net Charge | 0 |
| Average Mass | 347.378 |
| Monoisotopic Mass | 347.13822 |
| SMILES | N=C(N)Nc1ccc(C(=O)Oc2ccc3cc(C(=N)N)ccc3c2)cc1 |
| InChI | InChI=1S/C19H17N5O2/c20-17(21)14-2-1-13-10-16(8-5-12(13)9-14)26-18(25)11-3-6-15(7-4-11)24-19(22)23/h1-10H,(H3,20,21)(H4,22,23,24) |
| InChIKey | MQQNFDZXWVTQEH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nafamostat (CHEBI:135466) has role antiviral agent (CHEBI:22587) |
| nafamostat (CHEBI:135466) has role renoprotective agent (CHEBI:231911) |
| nafamostat (CHEBI:135466) is a benzoic acids (CHEBI:22723) |
| nafamostat (CHEBI:135466) is a guanidines (CHEBI:24436) |
| nafamostat (CHEBI:135466) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| nafamostat | WHO MedNet |
| Synonyms | Source |
|---|---|
| FUT-175 | DrugCentral |
| nafamostat dihydrochloride | DrugCentral |
| nafamostat HCl | DrugCentral |
| nafamostat hydrochloride | DrugCentral |
| nafamostat mesilate | DrugCentral |
| nafamostat mesylate | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1867 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:81525-10-2 | DrugCentral |
| Citations |
|---|