EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14AsNO3S2 |
| Net Charge | 0 |
| Average Mass | 347.293 |
| Monoisotopic Mass | 346.96311 |
| SMILES | CC(=O)Nc1cc([As]2SCC(CO)S2)ccc1O |
| InChI | InChI=1S/C11H14AsNO3S2/c1-7(15)13-10-4-8(2-3-11(10)16)12-17-6-9(5-14)18-12/h2-4,9,14,16H,5-6H2,1H3,(H,13,15) |
| InChIKey | MRUDSZSRLQAPOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsthinol (CHEBI:135465) has role antiamoebic agent (CHEBI:171664) |
| arsthinol (CHEBI:135465) is a acetamides (CHEBI:22160) |
| arsthinol (CHEBI:135465) is a anilide (CHEBI:13248) |
| INN | Source |
|---|---|
| arstinol | WHO MedNet |
| Synonyms | Source |
|---|---|
| arsthinenol | DrugCentral |
| Arsthinol | ChEMBL |
| balarsen | DrugCentral |
| mercaptoarsenol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3007 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:119-96-0 | DrugCentral |