EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O6S |
| Net Charge | 0 |
| Average Mass | 339.329 |
| Monoisotopic Mass | 339.05251 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)CC#N |
| InChI | InChI=1S/C13H13N3O6S/c1-6(17)22-4-7-5-23-12-9(15-8(18)2-3-14)11(19)16(12)10(7)13(20)21/h9,12H,2,4-5H2,1H3,(H,15,18)(H,20,21)/t9-,12-/m1/s1 |
| InChIKey | RRYMAQUWDLIUPV-BXKDBHETSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefacetrile (CHEBI:135437) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| cefacetrile sodium | DrugCentral |
| cephacetril | DrugCentral |
| cephacetrile | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 524 | DrugCentral |
| HMDB0015484 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:10206-21-0 | DrugCentral |