EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClN3O3S |
| Net Charge | 0 |
| Average Mass | 337.788 |
| Monoisotopic Mass | 337.02879 |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(c1ccccc1)NC2=O |
| InChI | InChI=1S/C14H12ClN3O3S/c15-10-7-11-9(6-12(10)22(16,20)21)14(19)18-13(17-11)8-4-2-1-3-5-8/h1-7,13,17H,(H,18,19)(H2,16,20,21) |
| InChIKey | DBDTUXMDTSTPQZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenquizone (CHEBI:135435) has role cardiovascular drug (CHEBI:35554) |
| fenquizone (CHEBI:135435) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| fenquizona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fenquizone | ChEMBL |
| fenquizone potassium | DrugCentral |
| idrolone | DrugCentral |
| M.G. 13054 | DrugCentral |
| MG 13054 | DrugCentral |
| MG-13054 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1162 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:20287-37-0 | DrugCentral |