EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18ClNO4 |
| Net Charge | 0 |
| Average Mass | 335.787 |
| Monoisotopic Mass | 335.09244 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCc1cccc(CO)n1 |
| InChI | InChI=1S/C17H18ClNO4/c1-17(2,23-15-8-6-12(18)7-9-15)16(21)22-11-14-5-3-4-13(10-20)19-14/h3-9,20H,10-11H2,1-2H3 |
| InChIKey | YJBIJSVYPHRVCI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pirifibrate (CHEBI:135427) is a monocarboxylic acid (CHEBI:25384) |
| INNs | Source |
|---|---|
| pirifibrate | WHO MedNet |
| pirifibrato | WHO MedNet |
| Synonym | Source |
|---|---|
| bratenol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2204 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:55285-45-5 | DrugCentral |