EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23NS |
| Net Charge | 0 |
| Average Mass | 333.500 |
| Monoisotopic Mass | 333.15512 |
| SMILES | [H]C12CCC([H])(CC(=C3c4ccccc4CSc4ccccc43)C1)N2C |
| InChI | InChI=1S/C22H23NS/c1-23-17-10-11-18(23)13-16(12-17)22-19-7-3-2-6-15(19)14-24-21-9-5-4-8-20(21)22/h2-9,17-18H,10-14H2,1H3 |
| InChIKey | JOQKFRLFXDPXHX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropatepine (CHEBI:135419) has role antiparkinson drug (CHEBI:48407) |
| tropatepine (CHEBI:135419) is a dibenzothiepine (CHEBI:38924) |
| INN | Source |
|---|---|
| tropatepina | WHO MedNet |
| Synonyms | Source |
|---|---|
| lepticur | DrugCentral |
| SD-1248-17 FREE BASE | ChEMBL |
| Tropatepine | ChEMBL |
| tropatepine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2772 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:27574-24-9 | DrugCentral |