EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26NO4 |
| Net Charge | +1 |
| Average Mass | 332.420 |
| Monoisotopic Mass | 332.18563 |
| SMILES | CC[N+]1(C)[C@@H]2C[C@@H](OC(=O)[C@H](CO)c3ccccc3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C19H26NO4/c1-3-20(2)15-9-13(10-16(20)18-17(15)24-18)23-19(22)14(11-21)12-7-5-4-6-8-12/h4-8,13-18,21H,3,9-11H2,1-2H3/q+1/t13-,14-,15-,16+,17-,18+,20?/m1/s1 |
| InChIKey | NVOYVOBDTVTBDX-PMEUIYRNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxitropium (CHEBI:135418) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| Synonyms | Source |
|---|---|
| oxytropium bromide | DrugCentral |
| oxitropium bromide | DrugCentral |
| oxitropium iodide | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2022 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:99571-64-9 | DrugCentral |