EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N5O4 |
| Net Charge | 0 |
| Average Mass | 329.316 |
| Monoisotopic Mass | 329.11240 |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)c2cccnc2)n(C)c1=O |
| InChI | InChI=1S/C15H15N5O4/c1-18-12-11(13(21)19(2)15(18)23)20(9-17-12)6-7-24-14(22)10-4-3-5-16-8-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | ZWIAODBBEZGVPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etofylline nicotinate (CHEBI:135405) has role cardiovascular drug (CHEBI:35554) |
| etofylline nicotinate (CHEBI:135405) is a oxopurine (CHEBI:25810) |
| Synonyms | Source |
|---|---|
| ethophylline nicotinate | DrugCentral |
| Etofylline nicotinate | ChEMBL |
| hesotanol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3212 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:13425-39-3 | DrugCentral |