EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22ClNO4 |
| Net Charge | 0 |
| Average Mass | 327.808 |
| Monoisotopic Mass | 327.12374 |
| SMILES | CN(C)C(=O)CCCOC(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO4/c1-16(2,22-13-9-7-12(17)8-10-13)15(20)21-11-5-6-14(19)18(3)4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | CXQGFLBVUNUQIA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofibride (CHEBI:135401) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| lipenan | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 696 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:26717-47-5 | DrugCentral |