EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13N5O4 |
| Net Charge | 0 |
| Average Mass | 327.300 |
| Monoisotopic Mass | 327.09675 |
| SMILES | O=C(CCn1cnc2c(=O)ncnc21)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H13N5O4/c21-11(19-10-3-1-9(2-4-10)15(23)24)5-6-20-8-18-12-13(20)16-7-17-14(12)22/h1-4,7-8H,5-6H2,(H,19,21)(H,23,24)(H,16,17,22) |
| InChIKey | JMPOIZCOJJMTHI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leteprinim (CHEBI:135395) is a amidobenzoic acid (CHEBI:48470) |
| Synonym | Source |
|---|---|
| leteprinim potassium | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3318 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:138117-50-7 | DrugCentral |