EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N2O |
| Net Charge | 0 |
| Average Mass | 326.484 |
| Monoisotopic Mass | 326.23581 |
| SMILES | CCCCN(CCN(CC)CC)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)20-14-10-12-18-11-8-9-13-19(18)20/h8-14H,4-7,15-17H2,1-3H3 |
| InChIKey | WWGZXRYELYWJBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bunaftine (CHEBI:135392) has role anti-arrhythmia drug (CHEBI:38070) |
| bunaftine (CHEBI:135392) is a naphthalenecarboxamide (CHEBI:48739) |
| INN | Source |
|---|---|
| bunaftina | WHO MedNet |
| Synonyms | Source |
|---|---|
| bunaftide | DrugCentral |
| Bunaftine | ChEMBL |
| bunaphtide | DrugCentral |
| Bunaphtine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 428 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:32421-46-8 | DrugCentral |