EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N3S |
| Net Charge | 0 |
| Average Mass | 323.465 |
| Monoisotopic Mass | 323.14562 |
| SMILES | CC(CN(C)C)CN1c2ccccc2Sc2ccc(C#N)cc21 |
| InChI | InChI=1S/C19H21N3S/c1-14(12-21(2)3)13-22-16-6-4-5-7-18(16)23-19-9-8-15(11-20)10-17(19)22/h4-10,14H,12-13H2,1-3H3 |
| InChIKey | SLFGIOIONGJGRT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyamemazine (CHEBI:135379) has role antipsychotic agent (CHEBI:35476) |
| cyamemazine (CHEBI:135379) is a organic molecular entity (CHEBI:50860) |
| cyamemazine (CHEBI:135379) is a phenothiazines (CHEBI:38093) |
| cyamemazine (CHEBI:135379) is a racemate (CHEBI:60911) |
| INN | Source |
|---|---|
| ciamemazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| ciamatil | DrugCentral |
| cianatil | DrugCentral |
| cyamemazin | DrugCentral |
| Cyamemazine | ChEMBL |
| cyamepromazine | DrugCentral |
| cyamepromezine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 746 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:3546-03-0 | DrugCentral |
| Citations |
|---|