EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClO2 |
| Net Charge | 0 |
| Average Mass | 322.876 |
| Monoisotopic Mass | 322.16996 |
| SMILES | [H][C@@]12CCC3=C(Cl)C(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H27ClO2/c1-18-10-8-15(21)17(20)14(18)4-3-11-12-5-6-16(22)19(12,2)9-7-13(11)18/h11-13,16,22H,3-10H2,1-2H3/t11-,12-,13-,16-,18+,19-/m0/s1 |
| InChIKey | KCZCIYZKSLLNNH-FBPKJDBXSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clostebol (CHEBI:135372) has role androgen (CHEBI:50113) |
| clostebol (CHEBI:135372) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| chlortestosterone | DrugCentral |
| cholostebol | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3112 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1093-58-9 | DrugCentral |