EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15NO3 |
| Net Charge | 0 |
| Average Mass | 317.344 |
| Monoisotopic Mass | 317.10519 |
| SMILES | O=C1Nc2ccccc2C1(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H15NO3/c22-15-9-5-13(6-10-15)20(14-7-11-16(23)12-8-14)17-3-1-2-4-18(17)21-19(20)24/h1-12,22-23H,(H,21,24) |
| InChIKey | SJDACOMXKWHBOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxyphenisatine (CHEBI:135358) has role laxative (CHEBI:50503) |
| oxyphenisatine (CHEBI:135358) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| oxifenisatina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Isaphen | ChEMBL |
| NSC-59814 | ChEMBL |
| oxyphenisatin | DrugCentral |
| Oxyphenisatine | ChEMBL |
| phenolisatin | DrugCentral |
| veripaque | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2038 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:125-13-3 | DrugCentral |
| Citations |
|---|