EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17BrN2 |
| Net Charge | 0 |
| Average Mass | 317.230 |
| Monoisotopic Mass | 316.05751 |
| SMILES | CN(C)C/C=C(/c1ccc(Br)cc1)c1cccnc1 |
| InChI | InChI=1S/C16H17BrN2/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13/h3-10,12H,11H2,1-2H3/b16-9- |
| InChIKey | OYPPVKRFBIWMSX-SXGWCWSVSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zimeldine (CHEBI:135357) has role antidepressant (CHEBI:35469) |
| zimeldine (CHEBI:135357) is a styrenes (CHEBI:26799) |
| INN | Source |
|---|---|
| zimeldina | WHO MedNet |
| Synonyms | Source |
|---|---|
| cis-Zimelidine | DrugCentral |
| Normud | ChEMBL |
| Zelmid | ChEMBL |
| Zimeldine | ChEMBL |
| zimeldine hydrochloride hydrate | DrugCentral |
| zimelidine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2863 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:56775-88-3 | DrugCentral |
| Citations |
|---|