EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3(C)O)[C@]1([H])[C@@H](C)CC1=CC(=O)CC[C@@]12C |
| InChI | InChI=1S/C21H32O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h12-13,16-18,23H,5-11H2,1-4H3/t13-,16-,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | IVFYLRMMHVYGJH-PVPPCFLZSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calusterone (CHEBI:135356) has role androgen (CHEBI:50113) |
| calusterone (CHEBI:135356) is a 3-hydroxy steroid (CHEBI:36834) |
| INNs | Source |
|---|---|
| calusterona | WHO MedNet |
| calusterone | WHO MedNet |
| Synonyms | Source |
|---|---|
| Dimethyltestosterone | ChEMBL |
| methosarb | DrugCentral |
| NSC-88536 | ChEMBL |
| U-22,550 | ChEMBL |
| U-22550 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 468 | DrugCentral |
| HMDB0004627 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:17021-26-0 | DrugCentral |
| Citations |
|---|