EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28N4O |
| Net Charge | 0 |
| Average Mass | 316.449 |
| Monoisotopic Mass | 316.22631 |
| SMILES | CCCCN(CCCC)CCNc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H28N4O/c1-3-5-13-22(14-6-4-2)15-12-19-18-20-17(21-23-18)16-10-8-7-9-11-16/h7-11H,3-6,12-15H2,1-2H3,(H,19,20,21) |
| InChIKey | VYWQZAARVNRSTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butalamine (CHEBI:135354) has role cardiovascular drug (CHEBI:35554) |
| butalamine (CHEBI:135354) is a organic molecular entity (CHEBI:50860) |
| butalamine (CHEBI:135354) is a oxadiazole (CHEBI:46685) |
| butalamine (CHEBI:135354) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| butalamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Butalamine | ChEMBL |
| butalamine HCl | DrugCentral |
| butalamine hydrochloride | DrugCentral |
| LA 1221 FREE BASE | ChEMBL |
| LA-1221 FREE BASE | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 440 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:22131-35-7 | DrugCentral |
| Citations |
|---|