EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NOS |
| Net Charge | 0 |
| Average Mass | 315.482 |
| Monoisotopic Mass | 315.16569 |
| SMILES | CCCN(CCc1cccs1)[C@H]1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C19H25NOS/c1-2-11-20(12-10-17-6-4-13-22-17)16-8-9-18-15(14-16)5-3-7-19(18)21/h3-7,13,16,21H,2,8-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | KFQYTPMOWPVWEJ-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rotigotine (CHEBI:135351) has role antiparkinson drug (CHEBI:48407) |
| rotigotine (CHEBI:135351) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| rotigotina | WHO MedNet |
| Synonyms | Source |
|---|---|
| leganto | DrugCentral |
| neupro | DrugCentral |
| Rotigotine | ChEMBL |
| SPM 962 | ChEMBL |
| SPM-962 | ChEMBL |
| (S)-(-)-Rotigotine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 2407 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:99755-59-6 | DrugCentral |
| Citations |
|---|