EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO2 |
| Net Charge | 0 |
| Average Mass | 313.441 |
| Monoisotopic Mass | 313.20418 |
| SMILES | CCC(O)c1ccc(OCCNC(C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H27NO2/c1-3-20(22)18-9-11-19(12-10-18)23-14-13-21-16(2)15-17-7-5-4-6-8-17/h4-12,16,20-22H,3,13-15H2,1-2H3 |
| InChIKey | DOBLSWXRNYSVDC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenalcomine (CHEBI:135345) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| fenalcomina | WHO MedNet |
| fenalcomine | WHO MedNet |
| Synonyms | Source |
|---|---|
| cordoxene | DrugCentral |
| fenalcomine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1144 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:34616-39-2 | DrugCentral |