EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO5 |
| Net Charge | 0 |
| Average Mass | 313.309 |
| Monoisotopic Mass | 313.09502 |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccccc2OC(C)=O)cc1 |
| InChI | InChI=1S/C17H15NO5/c1-11(19)18-13-7-9-14(10-8-13)23-17(21)15-5-3-4-6-16(15)22-12(2)20/h3-10H,1-2H3,(H,18,19) |
| InChIKey | FEJKLNWAOXSSNR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Application: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benorilate (CHEBI:135340) has role analgesic (CHEBI:35480) |
| benorilate (CHEBI:135340) is a carbonyl compound (CHEBI:36586) |
| INN | Source |
|---|---|
| benorilato | WHO MedNet |
| Synonyms | Source |
|---|---|
| benoral | DrugCentral |
| Benorilate | ChEMBL |
| benortan | DrugCentral |
| benorylate | DrugCentral |
| fenasprate | DrugCentral |
| quinexin | DrugCentral |
| Brand Name | Source |
|---|---|
| Triadol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 310 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:5003-48-5 | DrugCentral |
| Citations |
|---|