EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O |
| Net Charge | 0 |
| Average Mass | 308.425 |
| Monoisotopic Mass | 308.18886 |
| SMILES | CC(C)NCCCC1(C(N)=O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H24N2O/c1-14(2)22-13-7-12-20(19(21)23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20/h3-6,8-11,14,22H,7,12-13H2,1-2H3,(H2,21,23) |
| InChIKey | UCEWGESNIULAGX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indecainide (CHEBI:135314) is a fluorenes (CHEBI:24059) |
| Synonyms | Source |
|---|---|
| indecainide HCl | DrugCentral |
| ricainide | DrugCentral |
| decabid | DrugCentral |
| indecainide hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1434 | DrugCentral |
| HMDB0014338 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:74517-78-5 | DrugCentral |