EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12Br2O4 |
| Net Charge | 0 |
| Average Mass | 307.966 |
| Monoisotopic Mass | 305.91023 |
| SMILES | O[C@H]([C@H](O)[C@@H](O)CBr)[C@H](O)CBr |
| InChI | InChI=1S/C6H12Br2O4/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,9-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | VFKZTMPDYBFSTM-GUCUJZIJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitolactol (CHEBI:135311) has role antineoplastic agent (CHEBI:35610) |
| mitolactol (CHEBI:135311) is a alcohol (CHEBI:30879) |
| mitolactol (CHEBI:135311) is a organobromine compound (CHEBI:37141) |
| INN | Source |
|---|---|
| mitolactol | WHO MedNet |
| Synonyms | Source |
|---|---|
| dibromdulcit | DrugCentral |
| dibromodulcitol | DrugCentral |
| dibromogalactitol | DrugCentral |
| elobromol | DrugCentral |
| NCI-C04795 | ChEMBL |
| NSC-104800 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 857 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:10318-26-0 | DrugCentral |