EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O2S |
| Net Charge | 0 |
| Average Mass | 307.419 |
| Monoisotopic Mass | 307.13545 |
| SMILES | CCOc1ccc2nc(SCCN3CCOCC3)nc2c1 |
| InChI | InChI=1S/C15H21N3O2S/c1-2-20-12-3-4-13-14(11-12)17-15(16-13)21-10-7-18-5-8-19-9-6-18/h3-4,11H,2,5-10H2,1H3,(H,16,17) |
| InChIKey | WWNUCVSRRUDYPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fabomotizole (CHEBI:135309) has role anxiolytic drug (CHEBI:35474) |
| fabomotizole (CHEBI:135309) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| fabomotizol | WHO MedNet |
| Synonyms | Source |
|---|---|
| afobazol | DrugCentral |
| afobazole | DrugCentral |
| aphobazole | DrugCentral |
| CM-346 | ChEMBL |
| Fabomotizole | ChEMBL |
| Obenoxazine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4079 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:173352-21-1 | DrugCentral |
| Citations |
|---|