EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO4 |
| Net Charge | 0 |
| Average Mass | 307.390 |
| Monoisotopic Mass | 307.17836 |
| SMILES | CNCCc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H25NO4/c1-11(2)16(19)21-14-7-6-13(8-9-18-5)10-15(14)22-17(20)12(3)4/h6-7,10-12,18H,8-9H2,1-5H3 |
| InChIKey | WDKXLLJDNUBYCY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibopamine (CHEBI:135306) has role cardiovascular drug (CHEBI:35554) |
| ibopamine (CHEBI:135306) is a benzoate ester (CHEBI:36054) |
| ibopamine (CHEBI:135306) is a phenols (CHEBI:33853) |
| INN | Source |
|---|---|
| ibopamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ibopamine | ChEMBL |
| ibopamine HCl | DrugCentral |
| ibopamine hydrochloride | DrugCentral |
| SB 7505 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1405 | DrugCentral |
| HMDB0041906 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:66195-31-1 | DrugCentral |
| Citations |
|---|