EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N2O4S |
| Net Charge | 0 |
| Average Mass | 306.343 |
| Monoisotopic Mass | 306.06743 |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(NCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c15-10-1-5-12(6-2-10)21(19,20)13-7-3-11(4-8-13)16-9-14(17)18/h1-8,16H,9,15H2,(H,17,18) |
| InChIKey | FKKUMFTYSTZUJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acediasulfone (CHEBI:135300) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Acediasulphone | ChEMBL |
| N-p-sulfanilylphenylglycine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 44 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:80-03-5 | DrugCentral |
| Citations |
|---|