EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16ClNO3 |
| Net Charge | 0 |
| Average Mass | 305.761 |
| Monoisotopic Mass | 305.08187 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-16(2,21-14-7-5-13(17)6-8-14)15(19)20-11-12-4-3-9-18-10-12/h3-10H,11H2,1-2H3 |
| InChIKey | RARQHAFNGNPQCZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nicofibrate (CHEBI:135299) is a monocarboxylic acid (CHEBI:25384) |
| Synonym | Source |
|---|---|
| clofenpyride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1915 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:31980-29-7 | DrugCentral |