EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO4 |
| Net Charge | 0 |
| Average Mass | 305.374 |
| Monoisotopic Mass | 305.16271 |
| SMILES | C[N+]1([O-])[C@@H]2CC[C@H]1C[C@@H](OC(=O)C(CO)c1ccccc1)C2 |
| InChI | InChI=1S/C17H23NO4/c1-18(21)13-7-8-14(18)10-15(9-13)22-17(20)16(11-19)12-5-3-2-4-6-12/h2-6,13-16,19H,7-11H2,1H3/t13-,14+,15+,16?,18? |
| InChIKey | HGWPFSBHDACWNL-LZYIFBDPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atropine oxyde (CHEBI:135298) is a tropane alkaloid (CHEBI:37332) |
| Synonyms | Source |
|---|---|
| aminoxytropine tropate | DrugCentral |
| atropine aminoxide | DrugCentral |
| Atropine N-oxide | DrugCentral |
| atropine oxide | DrugCentral |
| genatropine | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 261 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:4438-22-6 | DrugCentral |