EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O8 |
| Net Charge | 0 |
| Average Mass | 304.255 |
| Monoisotopic Mass | 304.09067 |
| SMILES | CC(=O)N[C@@H](CC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16N2O8/c1-5(14)12-7(11(20)21)4-8(15)13-6(10(18)19)2-3-9(16)17/h6-7H,2-4H2,1H3,(H,12,14)(H,13,15)(H,16,17)(H,18,19)(H,20,21)/t6-,7-/m0/s1 |
| InChIKey | GUCKKCMJTSNWCU-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spaglumic acid (CHEBI:135289) has role nasal decongestant (CHEBI:77715) |
| spaglumic acid (CHEBI:135289) is a peptide (CHEBI:16670) |
| INNs | Source |
|---|---|
| acide spaglumique | WHO MedNet |
| acido espaglumico | WHO MedNet |
| Synonyms | Source |
|---|---|
| beta-NAAG | DrugCentral |
| NSC-758468 | ChEMBL |
| Spaglumic acid | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4050 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:4910-46-7 | DrugCentral |
| Citations |
|---|