EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22ClNO |
| Net Charge | 0 |
| Average Mass | 303.833 |
| Monoisotopic Mass | 303.13899 |
| SMILES | CN(C)CCOC(C)(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3 |
| InChIKey | KKHPNPMTPORSQE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphenoxamine (CHEBI:135288) has role anticoronaviral agent (CHEBI:149553) |
| chlorphenoxamine (CHEBI:135288) is a diarylmethane (CHEBI:51614) |
| Synonym | Source |
|---|---|
| chlorphenoxamine hydrochloride | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 617 | DrugCentral |
| HMDB0240223 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77-38-3 | DrugCentral |