EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N3O2 |
| Net Charge | 0 |
| Average Mass | 303.406 |
| Monoisotopic Mass | 303.19468 |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C17H25N3O2/c18-9-14-2-1-3-20(14)15(21)10-19-16-5-12-4-13(6-16)8-17(22,7-12)11-16/h12-14,19,22H,1-8,10-11H2/t12?,13?,14-,16?,17?/m0/s1 |
| InChIKey | SYOKIDBDQMKNDQ-XWTIBIIYSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vildagliptin (CHEBI:135285) has role antidepressant (CHEBI:35469) |
| vildagliptin (CHEBI:135285) has role antineoplastic agent (CHEBI:35610) |
| vildagliptin (CHEBI:135285) has role hypoglycemic agent (CHEBI:35526) |
| vildagliptin (CHEBI:135285) is a amino acid amide (CHEBI:22475) |
| INNs | Source |
|---|---|
| vildagliptina | WHO MedNet |
| vildagliptine | WHO MedNet |
| Synonyms | Source |
|---|---|
| galvus | DrugCentral |
| jalra | DrugCentral |
| LAF 237 | ChEMBL |
| LAF-237 | ChEMBL |
| LAF237 | ChEMBL |
| NVP-LAF 237 | ChEMBL |
| Brand Name | Source |
|---|---|
| Equa | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 3642 | DrugCentral |
| HMDB0015596 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:274901-16-5 | DrugCentral |
| Citations |
|---|