EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N4O4 |
| Net Charge | 0 |
| Average Mass | 302.290 |
| Monoisotopic Mass | 302.10150 |
| SMILES | O=C1NOCC1/N=C/c1ccc(/C=N/C2CONC2=O)cc1 |
| InChI | InChI=1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+ |
| InChIKey | ODKYYBOHSVLGNU-IAGONARPSA-N |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| terizidone (CHEBI:135278) has functional parent α-amino acid (CHEBI:33704) |
| terizidone (CHEBI:135278) has role antitubercular agent (CHEBI:33231) |
| terizidone (CHEBI:135278) is a organonitrogen compound (CHEBI:35352) |
| terizidone (CHEBI:135278) is a organooxygen compound (CHEBI:36963) |
| INN | Source |
|---|---|
| terizidona | WHO MedNet |
| Synonyms | Source |
|---|---|
| terivalidin | DrugCentral |
| terizidon | DrugCentral |
| Terizidone | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2602 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:25683-71-0 | DrugCentral |