EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NS2 |
| Net Charge | 0 |
| Average Mass | 301.480 |
| Monoisotopic Mass | 301.09589 |
| SMILES | CN(C)CC/C=C1\c2ccccc2CSc2sccc21 |
| InChI | InChI=1S/C17H19NS2/c1-18(2)10-5-8-15-14-7-4-3-6-13(14)12-20-17-16(15)9-11-19-17/h3-4,6-9,11H,5,10,12H2,1-2H3/b15-8+ |
| InChIKey | ZLJLUTCIUOCIQM-OVCLIPMQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-bisulepin (CHEBI:135277) is a dithiadene (CHEBI:167625) |
| IUPAC Name |
|---|
| (3E)-N,N-dimethyl-3-(thieno[2,3-c][2]benzothiepin-4(9H)-ylidene)propan-1-amine |
| Synonyms | Source |
|---|---|
| Bisulepin | ChEBI |
| bisulepine | DrugCentral |
| (E)-bisulepin | ChEBI |
| (E)-N,N-dimethyl-3-thieno[2,3-c][2]benzothiepin-4(9H)-ylidene-1-propanamine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Dithiaden | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:42504-83-6 | ChemIDplus |
| Citations |
|---|