EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9BrO2 |
| Net Charge | 0 |
| Average Mass | 301.139 |
| Monoisotopic Mass | 299.97859 |
| SMILES | O=C1c2ccc(Br)cc2C(=O)C1c1ccccc1 |
| InChI | InChI=1S/C15H9BrO2/c16-10-6-7-11-12(8-10)15(18)13(14(11)17)9-4-2-1-3-5-9/h1-8,13H |
| InChIKey | QFLZIWVSQDZLNW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | gout suppressant A drug that increases uric acid excretion by the kidney (uricosuric drug), decreases uric acid production (antihyperuricemic), or alleviates the pain and inflammation of acute attacks of gout. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobromindione (CHEBI:135275) has role gout suppressant (CHEBI:35845) |
| isobromindione (CHEBI:135275) is a cyclic ketone (CHEBI:3992) |
| isobromindione (CHEBI:135275) is a indanones (CHEBI:24789) |
| isobromindione (CHEBI:135275) is a organic molecular entity (CHEBI:50860) |
| isobromindione (CHEBI:135275) is a racemate (CHEBI:60911) |
| INN | Source |
|---|---|
| isobromindiona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Isobromindione | ChEMBL |
| uridion | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1488 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:1470-35-5 | DrugCentral |