EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClN2O |
| Net Charge | 0 |
| Average Mass | 300.789 |
| Monoisotopic Mass | 300.10294 |
| SMILES | CCNC1=Nc2ccc(Cl)cc2C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H17ClN2O/c1-3-19-16-20-15-10-9-13(18)11-14(15)17(2,21-16)12-7-5-4-6-8-12/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | IBYCYJFUEJQSMK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etifoxine (CHEBI:135272) has role anxiolytic drug (CHEBI:35474) |
| etifoxine (CHEBI:135272) is a benzoxazine (CHEBI:46969) |
| INN | Source |
|---|---|
| etifoxina | WHO MedNet |
| Synonyms | Source |
|---|---|
| etafenoxine | DrugCentral |
| etafenoxine hydrochloride | DrugCentral |
| etifoxin | DrugCentral |
| Etifoxine | ChEMBL |
| etifoxine hydrochloride | DrugCentral |
| HOE 36801 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1099 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:21715-46-8 | DrugCentral |
| Citations |
|---|